CAS 1119451-46-5

1-Butyl-1,2,3,4-tetrahydro-N-(3-methoxypropyl)-6-quinolinemethanamine

Description:

1-Butyl-1,2,3,4-tetrahydro-N-(3-methoxypropyl)-6-quinolinemethanamine is a chemical compound characterized by its complex structure, which includes a quinoline ring system and a tetrahydro configuration. This compound features a butyl group and a methoxypropyl substituent, contributing to its unique properties. It is likely to exhibit moderate to high lipophilicity due to the presence of hydrophobic alkyl chains, which can influence its solubility in organic solvents and biological membranes. The presence of the amine functional group suggests potential basicity and reactivity, particularly in forming salts or participating in hydrogen bonding. Additionally, the quinoline moiety may impart biological activity, as many quinoline derivatives are known for their pharmacological properties. The compound's specific applications and behavior in biological systems would depend on its interactions with various receptors or enzymes, making it of interest in medicinal chemistry and drug development. However, detailed studies would be necessary to fully elucidate its characteristics and potential uses.

Formula: C₁₈H₃₀N₂O

InChI: InChI=1S/C18H30N2O/c1-3-4-11-20-12-5-7-17-14-16(8-9-18(17)20)15-19-10-6-13-21-2/h8-9,14,19H,3-7,10-13,15H2,1-2H3

InChI key: InChIKey=DFZVZXQKIXJUHP-UHFFFAOYSA-N

SMILES: C(CCC)N1C=2C(=CC(CNCCCOC)=CC2)CCC1

Synonyms:

• 6-Quinolinemethanamine, 1-butyl-1,2,3,4-tetrahydro-N-(3-methoxypropyl)-
• 1-Butyl-1,2,3,4-tetrahydro-N-(3-methoxypropyl)-6-quinolinemethanamine