CymitQuimica logo

CAS 1119451-48-7

:

2-Bromo-N-[2-(3,4-diethoxyphenyl)ethyl]butanamide

Description:
2-Bromo-N-[2-(3,4-diethoxyphenyl)ethyl]butanamide is a chemical compound characterized by its unique structure, which includes a bromine atom, an amide functional group, and a substituted phenyl ring. The presence of the bromine atom indicates potential reactivity, particularly in nucleophilic substitution reactions. The diethoxyphenyl group contributes to the compound's hydrophobic characteristics and may influence its biological activity, making it of interest in medicinal chemistry. The butanamide portion of the molecule suggests that it may exhibit properties typical of amides, such as hydrogen bonding capabilities, which can affect solubility and stability. This compound may also display specific stereochemical configurations due to the presence of chiral centers, impacting its interaction with biological targets. Overall, 2-Bromo-N-[2-(3,4-diethoxyphenyl)ethyl]butanamide is a complex organic molecule with potential applications in pharmaceuticals or as a research chemical, warranting further investigation into its properties and effects.
Formula:C16H24BrNO3
InChI:InChI=1S/C16H24BrNO3/c1-4-13(17)16(19)18-10-9-12-7-8-14(20-5-2)15(11-12)21-6-3/h7-8,11,13H,4-6,9-10H2,1-3H3,(H,18,19)
InChI key:InChIKey=YMMQCCMNKOORRE-UHFFFAOYSA-N
SMILES:O(CC)C1=C(OCC)C=CC(CCNC(C(CC)Br)=O)=C1
Synonyms:
  • Butanamide, 2-bromo-N-[2-(3,4-diethoxyphenyl)ethyl]-
  • 2-Bromo-N-[2-(3,4-diethoxyphenyl)ethyl]butanamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.