CymitQuimica logo

CAS 1119451-51-2

:

2-Bromo-N-[(4-fluorophenyl)methyl]propanamide

Description:
2-Bromo-N-[(4-fluorophenyl)methyl]propanamide is a chemical compound characterized by its unique structure, which includes a bromine atom and a fluorinated phenyl group attached to a propanamide backbone. This compound features a bromo substituent at the second carbon of the propanamide chain, which can influence its reactivity and interaction with biological systems. The presence of the 4-fluorophenyl group enhances its lipophilicity, potentially affecting its pharmacokinetic properties. The amide functional group contributes to the compound's ability to form hydrogen bonds, which can be significant in biological activity and solubility. Additionally, the compound may exhibit specific stereochemical properties due to the presence of chiral centers, influencing its behavior in various chemical reactions and interactions. Overall, 2-Bromo-N-[(4-fluorophenyl)methyl]propanamide is of interest in medicinal chemistry and drug development, particularly for its potential applications in targeting specific biological pathways.
Formula:C10H11BrFNO
InChI:InChI=1S/C10H11BrFNO/c1-7(11)10(14)13-6-8-2-4-9(12)5-3-8/h2-5,7H,6H2,1H3,(H,13,14)
InChI key:InChIKey=OYWCZIUJNYVIMV-UHFFFAOYSA-N
SMILES:C(NC(C(Br)C)=O)C1=CC=C(F)C=C1
Synonyms:
  • Propanamide, 2-bromo-N-[(4-fluorophenyl)methyl]-
  • 2-Bromo-N-[(4-fluorophenyl)methyl]propanamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.