CAS 1119451-53-4

3-[[6-(3-Methylphenyl)-3-pyridazinyl]amino]benzoic acid

Description:

3-[[6-(3-Methylphenyl)-3-pyridazinyl]amino]benzoic acid, identified by its CAS number 1119451-53-4, is a chemical compound characterized by its complex structure, which includes a benzoic acid moiety and a pyridazine ring substituted with a 3-methylphenyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential for various chemical interactions. It may display moderate solubility in organic solvents and limited solubility in water, depending on the pH and the presence of functional groups. The presence of amino and carboxylic acid functional groups suggests that it could participate in hydrogen bonding and other intermolecular interactions, making it of interest in medicinal chemistry and materials science. Additionally, its structural features may confer specific biological activities, which could be explored in pharmaceutical applications. Overall, this compound represents a unique combination of functional groups that may lead to diverse chemical behavior and potential applications.

Formula: C₁₈H₁₅N₃O₂

InChI: InChI=1S/C18H15N3O2/c1-12-4-2-5-13(10-12)16-8-9-17(21-20-16)19-15-7-3-6-14(11-15)18(22)23/h2-11H,1H3,(H,19,21)(H,22,23)

InChI key: InChIKey=JKFUJGXOGBUTCS-UHFFFAOYSA-N

SMILES: CC=1C=C(C=CC1)C2=CC=C(NC3=CC(C(O)=O)=CC=C3)N=N2

Synonyms:

• Benzoic acid, 3-[[6-(3-methylphenyl)-3-pyridazinyl]amino]-
• 3-[[6-(3-Methylphenyl)-3-pyridazinyl]amino]benzoic acid