CAS 1119451-57-8

4,6-Dimethyl-5-(4-morpholinyl)-2-pyrimidinamine

Description:

4,6-Dimethyl-5-(4-morpholinyl)-2-pyrimidinamine is a chemical compound characterized by its pyrimidine core, which is a six-membered heterocyclic ring containing two nitrogen atoms at positions 2 and 4. The presence of two methyl groups at positions 4 and 6 contributes to its hydrophobic character, while the morpholine substituent at position 5 introduces a polar functional group, enhancing its solubility in polar solvents. This compound is typically classified as an amine due to the presence of the amino group, which can participate in hydrogen bonding and influence its reactivity. It may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of therapeutic agents. The molecular structure suggests potential interactions with biological targets, which could be explored in medicinal chemistry. Its CAS number, 1119451-57-8, allows for precise identification in chemical databases, facilitating research and development efforts. Overall, the unique combination of functional groups and structural features makes this compound a candidate for further investigation in various chemical and biological applications.

Formula: C₁₀H₁₆N₄O

InChI: InChI=1S/C10H16N4O/c1-7-9(8(2)13-10(11)12-7)14-3-5-15-6-4-14/h3-6H2,1-2H3,(H2,11,12,13)

InChI key: InChIKey=KNXQXPFXYYTSHJ-UHFFFAOYSA-N

SMILES: CC=1C(=C(C)N=C(N)N1)N2CCOCC2

Synonyms:

• 2-Pyrimidinamine, 4,6-dimethyl-5-(4-morpholinyl)-
• 4,6-Dimethyl-5-(4-morpholinyl)-2-pyrimidinamine