CymitQuimica logo

CAS 1119452-03-7

:

3-(Aminomethyl)-N-(2-amino-2-oxoethyl)-1,2,4-oxadiazole-5-carboxamide

Description:
3-(Aminomethyl)-N-(2-amino-2-oxoethyl)-1,2,4-oxadiazole-5-carboxamide is a chemical compound characterized by its oxadiazole ring, which contributes to its potential biological activity. The presence of amino and carboxamide functional groups suggests that it may exhibit polar characteristics, enhancing its solubility in polar solvents. This compound is likely to participate in hydrogen bonding due to the amino and carboxamide groups, which can influence its reactivity and interaction with biological targets. The oxadiazole moiety is known for its role in various pharmacological applications, including antimicrobial and anticancer activities. Additionally, the structural features indicate that it may be involved in various biochemical pathways, making it a candidate for further research in medicinal chemistry. Its specific properties, such as melting point, boiling point, and spectral data, would require experimental determination or literature references for precise characterization. Overall, this compound represents a class of heterocyclic compounds with potential therapeutic applications.
Formula:C6H9N5O3
InChI:InChI=1S/C6H9N5O3/c7-1-4-10-6(14-11-4)5(13)9-2-3(8)12/h1-2,7H2,(H2,8,12)(H,9,13)
InChI key:InChIKey=XCUMRZHXTCETJB-UHFFFAOYSA-N
SMILES:C(NCC(N)=O)(=O)C1=NC(CN)=NO1
Synonyms:
  • 1,2,4-Oxadiazole-5-carboxamide, 3-(aminomethyl)-N-(2-amino-2-oxoethyl)-
  • 3-(Aminomethyl)-N-(2-amino-2-oxoethyl)-1,2,4-oxadiazole-5-carboxamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.