CymitQuimica logo

CAS 1119452-07-1

:

3-[5-[(Dimethylamino)methyl]-1,2,4-oxadiazol-3-yl]benzaldehyde

Description:
3-[5-[(Dimethylamino)methyl]-1,2,4-oxadiazol-3-yl]benzaldehyde is a chemical compound characterized by its unique structure, which includes a benzaldehyde moiety and a 1,2,4-oxadiazole ring. The presence of the dimethylamino group enhances its potential for biological activity, making it of interest in medicinal chemistry. This compound typically exhibits properties such as moderate solubility in organic solvents and potential reactivity due to the aldehyde functional group, which can participate in various chemical reactions, including condensation and oxidation. The oxadiazole ring contributes to its stability and may influence its electronic properties, making it a candidate for applications in pharmaceuticals or agrochemicals. Additionally, the compound's molecular structure suggests potential interactions with biological targets, which could be explored in drug development. Overall, 3-[5-[(Dimethylamino)methyl]-1,2,4-oxadiazol-3-yl]benzaldehyde represents a versatile scaffold for further research in synthetic and medicinal chemistry.
Formula:C12H13N3O2
InChI:InChI=1S/C12H13N3O2/c1-15(2)7-11-13-12(14-17-11)10-5-3-4-9(6-10)8-16/h3-6,8H,7H2,1-2H3
InChI key:InChIKey=OJMGZTPXTZBRCS-UHFFFAOYSA-N
SMILES:C(N(C)C)C1=NC(=NO1)C2=CC(C=O)=CC=C2
Synonyms:
  • Benzaldehyde, 3-[5-[(dimethylamino)methyl]-1,2,4-oxadiazol-3-yl]-
  • 3-[5-[(Dimethylamino)methyl]-1,2,4-oxadiazol-3-yl]benzaldehyde
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.