CAS 1119452-10-6

4-[5-(Chloromethyl)-1,2,4-oxadiazol-3-yl]-N-[(5-methyl-2-furanyl)methyl]benzamide

Description:

4-[5-(Chloromethyl)-1,2,4-oxadiazol-3-yl]-N-[(5-methyl-2-furanyl)methyl]benzamide is a chemical compound characterized by its complex structure, which includes an oxadiazole ring, a chloromethyl group, and a benzamide moiety. The presence of the oxadiazole ring suggests potential applications in pharmaceuticals, particularly due to its heterocyclic nature, which can enhance biological activity. The chloromethyl group may serve as a reactive site for further chemical modifications or conjugations. Additionally, the incorporation of the 5-methyl-2-furanyl group indicates potential interactions with biological targets, as furan derivatives are often associated with various biological activities. This compound's molecular structure suggests it may exhibit properties such as antimicrobial, anti-inflammatory, or anticancer activities, although specific biological data would be necessary to confirm these effects. Its solubility, stability, and reactivity would depend on the surrounding conditions, including pH and solvent polarity. Overall, this compound represents a class of organic molecules with potential utility in medicinal chemistry and material science.

Formula: C₁₆H₁₄ClN₃O₃

InChI: InChI=1S/C16H14ClN3O3/c1-10-2-7-13(22-10)9-18-16(21)12-5-3-11(4-6-12)15-19-14(8-17)23-20-15/h2-7H,8-9H2,1H3,(H,18,21)

InChI key: InChIKey=MQOOQOXBXMRQQA-UHFFFAOYSA-N

SMILES: C(Cl)C1=NC(C2=CC=C(C(NCC=3OC(C)=CC3)=O)C=C2)=NO1

Synonyms:

• Benzamide, 4-[5-(chloromethyl)-1,2,4-oxadiazol-3-yl]-N-[(5-methyl-2-furanyl)methyl]-
• 4-[5-(Chloromethyl)-1,2,4-oxadiazol-3-yl]-N-[(5-methyl-2-furanyl)methyl]benzamide