CAS 1119452-11-7
:3-[5-(Chloromethyl)-1,2,4-oxadiazol-3-yl]-N-cyclopropyl-4-methoxybenzamide
Description:
3-[5-(Chloromethyl)-1,2,4-oxadiazol-3-yl]-N-cyclopropyl-4-methoxybenzamide is a synthetic organic compound characterized by its unique structural features, including a chloromethyl group, an oxadiazole ring, and a methoxy-substituted benzamide moiety. The presence of the oxadiazole ring contributes to its potential biological activity, as oxadiazoles are often associated with various pharmacological properties. The cyclopropyl group in the amide structure may influence the compound's steric and electronic properties, potentially affecting its interaction with biological targets. This compound is likely to exhibit moderate to high lipophilicity due to the aromatic and aliphatic components, which can affect its solubility and permeability. Additionally, the chloromethyl group may serve as a reactive site for further chemical modifications or interactions. Overall, this compound's unique combination of functional groups suggests potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. However, specific biological activity and safety profiles would require further investigation through experimental studies.
Formula:C14H14ClN3O3
InChI:InChI=1S/C14H14ClN3O3/c1-20-11-5-2-8(14(19)16-9-3-4-9)6-10(11)13-17-12(7-15)21-18-13/h2,5-6,9H,3-4,7H2,1H3,(H,16,19)
InChI key:InChIKey=JYTXGDRKJGUTFZ-UHFFFAOYSA-N
SMILES:O(C)C1=C(C=C(C(NC2CC2)=O)C=C1)C=3N=C(CCl)ON3
Synonyms:- 3-[5-(Chloromethyl)-1,2,4-oxadiazol-3-yl]-N-cyclopropyl-4-methoxybenzamide
- Benzamide, 3-[5-(chloromethyl)-1,2,4-oxadiazol-3-yl]-N-cyclopropyl-4-methoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.