CAS 1119452-16-2

5-Ethyl-4-methyl-3-isoxazolecarboxylic acid

Description:

5-Ethyl-4-methyl-3-isoxazolecarboxylic acid is a heterocyclic organic compound characterized by the presence of an isoxazole ring, which is a five-membered ring containing both nitrogen and oxygen atoms. This compound features an ethyl group and a methyl group as substituents on the isoxazole ring, contributing to its unique chemical properties. The carboxylic acid functional group (-COOH) enhances its acidity and solubility in polar solvents, making it potentially useful in various chemical reactions and applications. The presence of the isoxazole moiety suggests potential biological activity, as many isoxazole derivatives are known for their pharmacological properties. Additionally, the compound's structure may influence its reactivity, stability, and interaction with other molecules. Its specific applications could range from pharmaceuticals to agrochemicals, depending on its biological activity and chemical behavior. As with any chemical substance, safety data and handling precautions should be considered when working with this compound.

Formula: C₇H₉NO₃

InChI: InChI=1S/C7H9NO3/c1-3-5-4(2)6(7(9)10)8-11-5/h3H2,1-2H3,(H,9,10)

InChI key: InChIKey=NLPZJLKNFKANHZ-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C(C)=C(CC)ON1

Synonyms:

• 3-Isoxazolecarboxylic acid, 5-ethyl-4-methyl-
• 5-Ethyl-4-methyl-1,2-oxazole-3-carboxylic acid
• 5-Ethyl-4-methyl-3-isoxazolecarboxylic acid