CAS 1119452-17-3
:3-[4-Methoxy-3-[(2-methyl-1H-imidazol-1-yl)methyl]phenyl]-2-propenoic acid
Description:
3-[4-Methoxy-3-[(2-methyl-1H-imidazol-1-yl)methyl]phenyl]-2-propenoic acid, identified by its CAS number 1119452-17-3, is a synthetic organic compound characterized by its complex structure, which includes a propenoic acid moiety and a methoxy-substituted phenyl group. This compound features an imidazole ring, which contributes to its potential biological activity, particularly in medicinal chemistry. The presence of the methoxy group enhances its lipophilicity, potentially influencing its solubility and permeability in biological systems. The propenoic acid functional group suggests that it may participate in various chemical reactions, including polymerization or esterification. Additionally, the imidazole moiety is known for its role in various biological processes, making this compound of interest in pharmaceutical research. Its unique structural features may confer specific interactions with biological targets, which could be explored for therapeutic applications. Overall, this compound exemplifies the intricate relationship between molecular structure and biological activity in the field of organic and medicinal chemistry.
Formula:C15H16N2O3
InChI:InChI=1S/C15H16N2O3/c1-11-16-7-8-17(11)10-13-9-12(4-6-15(18)19)3-5-14(13)20-2/h3-9H,10H2,1-2H3,(H,18,19)
InChI key:InChIKey=IJNCJOZURTVITM-UHFFFAOYSA-N
SMILES:C(C1=C(OC)C=CC(C=CC(O)=O)=C1)N2C(C)=NC=C2
Synonyms:- 3-[4-Methoxy-3-[(2-methyl-1H-imidazol-1-yl)methyl]phenyl]-2-propenoic acid
- 2-Propenoic acid, 3-[4-methoxy-3-[(2-methyl-1H-imidazol-1-yl)methyl]phenyl]-
- (2E)-3-{4-methoxy-3-[(2-methyl-1H-imidazol-1-yl)methyl]phenyl}acrylic acid
- (E)-3-(4-methoxy-3-((2-methyl-1H-imidazol-1-yl)methyl)phenyl)acrylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.