CAS 1119452-18-4

5-Methyl-4-[(4-methyl-1-piperidinyl)methyl]-3-isoxazolecarboxylic acid

Description:

5-Methyl-4-[(4-methyl-1-piperidinyl)methyl]-3-isoxazolecarboxylic acid is a chemical compound characterized by its unique isoxazole ring structure, which is a five-membered heterocyclic compound containing both nitrogen and oxygen. This substance features a carboxylic acid functional group, contributing to its acidic properties. The presence of a piperidine moiety, specifically a 4-methyl-1-piperidinyl group, suggests potential interactions with biological systems, possibly influencing its pharmacological activity. The methyl groups attached to the isoxazole and piperidine rings may enhance lipophilicity, affecting the compound's solubility and permeability. This compound is of interest in medicinal chemistry, particularly for its potential therapeutic applications. Its specific characteristics, such as melting point, solubility, and reactivity, would depend on the molecular interactions and the environment in which it is studied. As with many compounds, safety and handling precautions are essential due to the potential for biological activity and toxicity.

Formula: C₁₂H₁₈N₂O₃

InChI: InChI=1S/C12H18N2O3/c1-8-3-5-14(6-4-8)7-10-9(2)17-13-11(10)12(15)16/h8H,3-7H2,1-2H3,(H,15,16)

InChI key: InChIKey=UXKGSSSJURGDSL-UHFFFAOYSA-N

SMILES: C(C=1C(C(O)=O)=NOC1C)N2CCC(C)CC2

Synonyms:

• 3-Isoxazolecarboxylic acid, 5-methyl-4-[(4-methyl-1-piperidinyl)methyl]-
• 5-Methyl-4-[(4-methyl-1-piperidinyl)methyl]-3-isoxazolecarboxylic acid

5-Methyl-4-((4-methylpiperidin-1-yl)methyl)isoxazole-3-carboxylic acid

CAS: 1119452-18-4

5-Methyl-4-((4-methylpiperidin-1-yl)methyl)isoxazole-3-carboxylic acid

Purity: 95%

Molecular weight: 238.29g/mol

Ref: 54-OR1064379