CAS 1119452-22-0

Ethyl 3-(5-pyrimidinyl)-1,2,4-triazolo[4,3-a]pyridine-6-carboxylate

Description:

Ethyl 3-(5-pyrimidinyl)-1,2,4-triazolo[4,3-a]pyridine-6-carboxylate is a chemical compound characterized by its complex heterocyclic structure, which includes a pyridine ring, a pyrimidine moiety, and a triazole unit. This compound typically exhibits properties associated with heterocycles, such as potential biological activity, making it of interest in medicinal chemistry. It is likely to be a solid at room temperature, with moderate solubility in organic solvents due to its polar functional groups. The presence of the ethyl ester group suggests it may undergo hydrolysis under acidic or basic conditions, releasing the corresponding carboxylic acid. Additionally, the compound may exhibit various functional properties, including potential antimicrobial or anti-inflammatory activities, which are common in compounds containing triazole and pyridine derivatives. Its molecular structure allows for interactions with biological targets, making it a candidate for further pharmacological studies. Safety data and handling precautions should be consulted, as with any chemical substance, to ensure proper laboratory practices.

Formula: C₁₃H₁₁N₅O₂

InChI: InChI=1S/C13H11N5O2/c1-2-20-13(19)9-3-4-11-16-17-12(18(11)7-9)10-5-14-8-15-6-10/h3-8H,2H2,1H3

InChI key: InChIKey=CNGDYWVUIILUMH-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C1=CN2C(=NN=C2C=C1)C=3C=NC=NC3

Synonyms:

• Ethyl 3-(5-pyrimidinyl)-1,2,4-triazolo[4,3-a]pyridine-6-carboxylate
• 1,2,4-Triazolo[4,3-a]pyridine-6-carboxylic acid, 3-(5-pyrimidinyl)-, ethyl ester