CAS 1119452-25-3

6-[(2-Chlorophenyl)methyl]-5,7-dimethylpyrazolo[1,5-a]pyrimidine-3-carboxylic acid

Description:

6-[(2-Chlorophenyl)methyl]-5,7-dimethylpyrazolo[1,5-a]pyrimidine-3-carboxylic acid is a chemical compound characterized by its complex structure, which includes a pyrazolo-pyrimidine core. This compound features a carboxylic acid functional group, contributing to its acidic properties. The presence of a 2-chlorophenyl group enhances its potential for biological activity, possibly influencing its interaction with various biological targets. The dimethyl substitutions at the 5 and 7 positions of the pyrazolo ring may affect the compound's steric and electronic properties, potentially impacting its solubility and reactivity. This compound is of interest in medicinal chemistry, particularly for its potential pharmacological applications. Its unique structure may allow for specific interactions with enzymes or receptors, making it a candidate for further research in drug development. As with many chemical substances, safety and handling precautions should be observed, and its properties should be evaluated through appropriate experimental methods to understand its behavior in various environments.

Formula: C₁₆H₁₄ClN₃O₂

InChI: InChI=1S/C16H14ClN3O2/c1-9-12(7-11-5-3-4-6-14(11)17)10(2)20-15(19-9)13(8-18-20)16(21)22/h3-6,8H,7H2,1-2H3,(H,21,22)

InChI key: InChIKey=UDQITYIDAKATNG-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C2N(C(C)=C(CC3=C(Cl)C=CC=C3)C(C)=N2)N=C1

Synonyms:

• 6-[(2-Chlorophenyl)methyl]-5,7-dimethylpyrazolo[1,5-a]pyrimidine-3-carboxylic acid
• Pyrazolo[1,5-a]pyrimidine-3-carboxylic acid, 6-[(2-chlorophenyl)methyl]-5,7-dimethyl-