CAS 1119452-29-7

6-(3-Fluorophenyl)imidazo[2,1-b]thiazole-3-carboxylic acid

Description:

6-(3-Fluorophenyl)imidazo[2,1-b]thiazole-3-carboxylic acid is a heterocyclic compound characterized by its imidazole and thiazole rings, which contribute to its biological activity and potential pharmaceutical applications. The presence of a fluorophenyl group enhances its lipophilicity and may influence its interaction with biological targets. This compound features a carboxylic acid functional group, which can participate in hydrogen bonding and may enhance solubility in polar solvents. Its structural complexity allows for various potential interactions in biological systems, making it a candidate for research in medicinal chemistry. The compound's unique combination of heteroatoms and functional groups suggests potential applications in drug development, particularly in targeting specific enzymes or receptors. Additionally, the fluorine atom can modulate the electronic properties of the molecule, potentially affecting its pharmacokinetics and pharmacodynamics. Overall, this compound exemplifies the intricate design often found in small molecules aimed at therapeutic use.

Formula: C₁₂H₇FN₂O₂S

InChI: InChI=1S/C12H7FN2O2S/c13-8-3-1-2-7(4-8)9-5-15-10(11(16)17)6-18-12(15)14-9/h1-6H,(H,16,17)

InChI key: InChIKey=WSKWNRLRMWOSGB-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1N2C(=NC(=C2)C3=CC(F)=CC=C3)SC1

Synonyms:

• Imidazo[2,1-b]thiazole-3-carboxylic acid, 6-(3-fluorophenyl)-
• 6-(3-Fluorophenyl)imidazo[2,1-b]thiazole-3-carboxylic acid