CAS 1119452-30-0: 2-[(Hexahydro-1H-azepin-1-yl)methyl]-4-methoxybenzaldehyde
Description:2-[(Hexahydro-1H-azepin-1-yl)methyl]-4-methoxybenzaldehyde is an organic compound characterized by its unique structure, which includes a methoxy group and an aldehyde functional group attached to a benzene ring. The presence of the hexahydro-1H-azepin moiety introduces a cyclic amine component, contributing to its potential biological activity. This compound is likely to exhibit moderate polarity due to the combination of hydrophobic aromatic and hydrophilic functional groups. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as the azepine ring can influence receptor interactions and biological pathways. Additionally, the aldehyde group may participate in various chemical reactions, such as condensation or reduction, making it a versatile intermediate in organic synthesis. The compound's stability, solubility, and reactivity would depend on the specific conditions and solvents used in experiments. Overall, 2-[(Hexahydro-1H-azepin-1-yl)methyl]-4-methoxybenzaldehyde represents a complex organic molecule with potential implications in various chemical and pharmaceutical applications.
Formula:C15H21NO2
InChI:InChI=1S/C15H21NO2/c1-18-15-7-6-13(12-17)14(10-15)11-16-8-4-2-3-5-9-16/h6-7,10,12H,2-5,8-9,11H2,1H3
InChI key:InChIKey=DJHCBWIPUKKNTQ-UHFFFAOYSA-N
SMILES:O=CC1=CC=C(OC)C=C1CN2CCCCCC2
- Synonyms:
- 2-[(Hexahydro-1H-azepin-1-yl)methyl]-4-methoxybenzaldehyde
- Benzaldehyde, 2-[(hexahydro-1H-azepin-1-yl)methyl]-4-methoxy-
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 2-(Azepan-1-ylmethyl)-4-methoxybenzaldehyde REF: 3D-FA117712CAS: 1119452-30-0 | Min. 95% | - - - | Discontinued product |

2-(Azepan-1-ylmethyl)-4-methoxybenzaldehyde
Ref: 3D-FA117712
1g | Discontinued | Request information | |
2g | Discontinued | Request information | |
5g | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |