CAS 1119452-33-3
:2-Bromo-N-(2-methoxyethyl)butanamide
Description:
2-Bromo-N-(2-methoxyethyl)butanamide is an organic compound characterized by its amide functional group, which is derived from butanoic acid. The presence of a bromine atom indicates it is a bromo-substituted derivative, which can influence its reactivity and potential applications in organic synthesis. The methoxyethyl group contributes to the compound's solubility and polarity, making it suitable for various chemical reactions. This compound may exhibit moderate to high stability under standard conditions, but its reactivity can be enhanced in the presence of nucleophiles or under specific catalytic conditions. The molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of the amide bond, which is often found in biologically active molecules. Additionally, the bromine substituent can serve as a leaving group in substitution reactions, further expanding its utility in synthetic pathways. As with any chemical substance, safety precautions should be observed when handling it, considering potential hazards associated with brominated compounds.
Formula:C7H14BrNO2
InChI:InChI=1S/C7H14BrNO2/c1-3-6(8)7(10)9-4-5-11-2/h6H,3-5H2,1-2H3,(H,9,10)
InChI key:InChIKey=LWLRQNKGVQBZOI-UHFFFAOYSA-N
SMILES:C(NCCOC)(C(CC)Br)=O
Synonyms:- 2-Bromo-N-(2-methoxyethyl)butanamide
- Butanamide, 2-bromo-N-(2-methoxyethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.