CymitQuimica logo

CAS 1119452-34-4

:

2-Bromo-N-[3-(diethylamino)propyl]butanamide

Description:
2-Bromo-N-[3-(diethylamino)propyl]butanamide is a chemical compound characterized by its unique structure, which includes a bromine atom, a butanamide moiety, and a diethylamino group. This compound features a bromine substituent at the second position of the butanamide chain, which can influence its reactivity and biological activity. The presence of the diethylamino group suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as such amines often exhibit significant biological properties. The compound's molecular structure indicates it may participate in various chemical reactions, including nucleophilic substitutions due to the bromine atom. Additionally, the presence of both hydrophilic (amide) and hydrophobic (alkyl) components in its structure may affect its solubility and interaction with biological membranes. Overall, 2-Bromo-N-[3-(diethylamino)propyl]butanamide is of interest for its potential applications in drug development and its unique chemical properties.
Formula:C11H23BrN2O
InChI:InChI=1S/C11H23BrN2O/c1-4-10(12)11(15)13-8-7-9-14(5-2)6-3/h10H,4-9H2,1-3H3,(H,13,15)
InChI key:InChIKey=SRHPKKPTXFUXHX-UHFFFAOYSA-N
SMILES:N(CCCNC(C(CC)Br)=O)(CC)CC
Synonyms:
  • Butanamide, 2-bromo-N-[3-(diethylamino)propyl]-
  • 2-Bromo-N-[3-(diethylamino)propyl]butanamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.