CymitQuimica logo

CAS 1119452-35-5

:

2-Bromo-N-(4-fluorophenyl)butanamide

Description:
2-Bromo-N-(4-fluorophenyl)butanamide is a chemical compound characterized by its specific functional groups and structural features. It contains a butanamide backbone, which is an amide derived from butanoic acid, with a bromine atom attached to the second carbon of the butane chain. Additionally, it features a 4-fluorophenyl group, indicating the presence of a fluorine atom on the para position of a phenyl ring, which is attached to the nitrogen of the amide. This compound is likely to exhibit moderate polarity due to the presence of both the amide and halogen functional groups, influencing its solubility in various solvents. The bromine and fluorine substituents can also impart unique reactivity and biological activity, making it of interest in medicinal chemistry and material science. Its molecular structure suggests potential applications in pharmaceuticals, particularly in the development of compounds with specific biological activities. As with many halogenated compounds, safety and handling precautions are essential due to potential toxicity and environmental impact.
Formula:C10H11BrFNO
InChI:InChI=1S/C10H11BrFNO/c1-2-9(11)10(14)13-8-5-3-7(12)4-6-8/h3-6,9H,2H2,1H3,(H,13,14)
InChI key:InChIKey=DILDYQZQIHEIPY-UHFFFAOYSA-N
SMILES:N(C(C(CC)Br)=O)C1=CC=C(F)C=C1
Synonyms:
  • Butanamide, 2-bromo-N-(4-fluorophenyl)-
  • 2-Bromo-N-(4-fluorophenyl)butanamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.