CAS 1119452-37-7
:2-Bromo-1-[4-(2-pyrimidinyl)-1-piperazinyl]-1-butanone
Description:
2-Bromo-1-[4-(2-pyrimidinyl)-1-piperazinyl]-1-butanone is a chemical compound characterized by its complex structure, which includes a bromine atom, a butanone moiety, and a piperazine ring substituted with a pyrimidine group. This compound typically exhibits properties associated with both halogenated and nitrogen-containing organic compounds, such as moderate solubility in polar solvents and potential reactivity due to the presence of the bromine atom. The piperazine and pyrimidine components suggest potential biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. The presence of the bromine atom may enhance lipophilicity and influence the compound's interaction with biological targets. Additionally, the molecular structure indicates potential for hydrogen bonding and other intermolecular interactions, which can affect its physical properties, such as melting and boiling points. Overall, 2-Bromo-1-[4-(2-pyrimidinyl)-1-piperazinyl]-1-butanone is a compound of interest for further study in various chemical and biological applications.
Formula:C12H17BrN4O
InChI:InChI=1S/C12H17BrN4O/c1-2-10(13)11(18)16-6-8-17(9-7-16)12-14-4-3-5-15-12/h3-5,10H,2,6-9H2,1H3
InChI key:InChIKey=FWRXAXJDIDKPIS-UHFFFAOYSA-N
SMILES:C(C(CC)Br)(=O)N1CCN(CC1)C=2N=CC=CN2
Synonyms:- 2-Bromo-1-[4-(2-pyrimidinyl)-1-piperazinyl]-1-butanone
- 1-Butanone, 2-bromo-1-[4-(2-pyrimidinyl)-1-piperazinyl]-
- 2-[4-(2-Bromobutanoyl)Piperazin-1-Yl]Pyrimidine
- 2-Bromo-1-(4-(pyrimidin-2-yl)piperazin-1-yl)butan-1-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.