CAS 1119452-40-2

3-(Butylthio)-1-butanamine

Description:

3-(Butylthio)-1-butanamine is an organic compound characterized by the presence of a butylthio group and an amine functional group. It features a butyl chain attached to a sulfur atom, which is further connected to a butanamine structure. This compound is likely to be a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is expected to be soluble in organic solvents due to its hydrophobic butyl groups, while the amine functionality may impart some degree of polarity. The presence of the amine group suggests that it can participate in hydrogen bonding, which may influence its boiling and melting points. Additionally, 3-(Butylthio)-1-butanamine may exhibit basic properties typical of amines, allowing it to act as a nucleophile in various chemical reactions. Its potential applications could span fields such as pharmaceuticals, agrochemicals, or materials science, although specific uses would depend on further research and development. Safety data should be consulted for handling and storage, as with any chemical substance.

Formula: C₈H₁₉NS

InChI: InChI=1S/C8H19NS/c1-3-4-7-10-8(2)5-6-9/h8H,3-7,9H2,1-2H3

InChI key: InChIKey=MJOKXMNJUVAMMB-UHFFFAOYSA-N

SMILES: S(C(CCN)C)CCCC

Synonyms:

• 1-Butanamine, 3-(butylthio)-
• 3-(Butylthio)-1-butanamine