CAS 1119452-41-3

2-Bromo-N-(1-methyl-3-phenylpropyl)butanamide

Description:

2-Bromo-N-(1-methyl-3-phenylpropyl)butanamide is a chemical compound characterized by its specific functional groups and structural features. It contains a bromine atom, which contributes to its reactivity, particularly in nucleophilic substitution reactions. The presence of the butanamide moiety indicates that it has an amide functional group, which typically imparts properties such as increased polarity and potential hydrogen bonding capabilities. The compound also features a branched alkyl chain with a phenyl group, suggesting that it may exhibit hydrophobic characteristics alongside its polar amide functionality. This dual nature can influence its solubility in various solvents, making it potentially useful in organic synthesis and medicinal chemistry. Additionally, the presence of the bromine atom may enhance its utility in further chemical transformations, such as coupling reactions or as a leaving group in substitution reactions. Overall, the structural complexity of 2-Bromo-N-(1-methyl-3-phenylpropyl)butanamide suggests it may have interesting biological or chemical properties worthy of exploration in research and application.

Formula: C₁₄H₂₀BrNO

InChI: InChI=1S/C14H20BrNO/c1-3-13(15)14(17)16-11(2)9-10-12-7-5-4-6-8-12/h4-8,11,13H,3,9-10H2,1-2H3,(H,16,17)

InChI key: InChIKey=UYQUUPBNGHHXGK-UHFFFAOYSA-N

SMILES: C(CC(NC(C(CC)Br)=O)C)C1=CC=CC=C1

Synonyms:

• 2-Bromo-N-(1-methyl-3-phenylpropyl)butanamide
• Butanamide, 2-bromo-N-(1-methyl-3-phenylpropyl)-