CAS 1119452-42-4

2-Bromo-1-[4-(phenylmethyl)-1-piperidinyl]-1-butanone

Description:

2-Bromo-1-[4-(phenylmethyl)-1-piperidinyl]-1-butanone is a chemical compound characterized by its complex structure, which includes a bromine atom, a butanone moiety, and a piperidine ring substituted with a phenylmethyl group. This compound typically exhibits properties associated with both halogenated and amine-containing organic compounds. It may be a solid or liquid at room temperature, depending on its specific formulation and purity. The presence of the bromine atom suggests potential reactivity in nucleophilic substitution reactions, while the piperidine ring can impart basicity and potential interactions with biological systems. The phenylmethyl group contributes to the compound's lipophilicity, which may influence its solubility in organic solvents. Additionally, compounds of this nature may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to their structural features that can interact with biological targets. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity or reactivity.

Formula: C₁₆H₂₂BrNO

InChI: InChI=1S/C16H22BrNO/c1-2-15(17)16(19)18-10-8-14(9-11-18)12-13-6-4-3-5-7-13/h3-7,14-15H,2,8-12H2,1H3

InChI key: InChIKey=AHRXIRJITLECJP-UHFFFAOYSA-N

SMILES: C(C(CC)Br)(=O)N1CCC(CC2=CC=CC=C2)CC1

Synonyms:

• 2-Bromo-1-[4-(phenylmethyl)-1-piperidinyl]-1-butanone
• 1-Butanone, 2-bromo-1-[4-(phenylmethyl)-1-piperidinyl]-