CAS 1119452-44-6

2-Bromo-N-(2,5-difluorophenyl)butanamide

Description:

2-Bromo-N-(2,5-difluorophenyl)butanamide is a chemical compound characterized by its unique structure, which includes a butanamide backbone substituted with a bromine atom and a 2,5-difluorophenyl group. This compound typically exhibits properties associated with amides, such as moderate polarity due to the presence of the amide functional group, which can engage in hydrogen bonding. The bromine substituent can influence the compound's reactivity, potentially making it a good candidate for nucleophilic substitution reactions. The difluorophenyl group introduces additional electronic effects, which can affect the compound's overall stability and reactivity. In terms of solubility, compounds of this nature may be soluble in organic solvents but less so in water due to their hydrophobic characteristics. The presence of fluorine atoms can enhance lipophilicity and alter the compound's biological activity, making it of interest in medicinal chemistry. Overall, 2-Bromo-N-(2,5-difluorophenyl)butanamide is a compound with potential applications in pharmaceuticals and organic synthesis, warranting further investigation into its properties and reactivity.

Formula: C₁₀H₁₀BrF₂NO

InChI: InChI=1S/C10H10BrF2NO/c1-2-7(11)10(15)14-9-5-6(12)3-4-8(9)13/h3-5,7H,2H2,1H3,(H,14,15)

InChI key: InChIKey=GYSGKGJEUKIUAZ-UHFFFAOYSA-N

SMILES: N(C(C(CC)Br)=O)C1=C(F)C=CC(F)=C1

Synonyms:

• 2-Bromo-N-(2,5-difluorophenyl)butanamide
• Butanamide, 2-bromo-N-(2,5-difluorophenyl)-