CAS 1119452-45-7
:2-Bromo-N-(5-chloro-2,4-dimethoxyphenyl)propanamide
Description:
2-Bromo-N-(5-chloro-2,4-dimethoxyphenyl)propanamide is a chemical compound characterized by its complex structure, which includes a bromine atom, a chloro-substituted aromatic ring, and a propanamide functional group. This compound features a bromine atom at the second position of the propanamide chain, which can influence its reactivity and biological activity. The presence of the 5-chloro-2,4-dimethoxyphenyl moiety suggests potential applications in medicinal chemistry, as modifications on aromatic rings can significantly affect pharmacological properties. The methoxy groups contribute to the compound's lipophilicity, potentially enhancing its ability to cross biological membranes. Additionally, the chlorine atom may impart unique electronic properties, influencing the compound's interactions with biological targets. Overall, the structural characteristics of 2-Bromo-N-(5-chloro-2,4-dimethoxyphenyl)propanamide suggest it may be of interest in research related to drug development or as a synthetic intermediate in organic chemistry.
Formula:C11H13BrClNO3
InChI:InChI=1S/C11H13BrClNO3/c1-6(12)11(15)14-8-4-7(13)9(16-2)5-10(8)17-3/h4-6H,1-3H3,(H,14,15)
InChI key:InChIKey=JWCTYFYKSHTYGX-UHFFFAOYSA-N
SMILES:N(C(C(Br)C)=O)C1=C(OC)C=C(OC)C(Cl)=C1
Synonyms:- Propanamide, 2-bromo-N-(5-chloro-2,4-dimethoxyphenyl)-
- 2-Bromo-N-(5-chloro-2,4-dimethoxyphenyl)propanamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.