CymitQuimica logo

CAS 1119452-46-8

:

2-Bromo-N-[(3-methoxyphenyl)methyl]butanamide

Description:
2-Bromo-N-[(3-methoxyphenyl)methyl]butanamide is a chemical compound characterized by its specific functional groups and structural features. It contains a bromine atom, which contributes to its reactivity and potential applications in organic synthesis. The presence of the butanamide moiety indicates that it is an amide, which typically exhibits properties such as moderate polarity and the ability to participate in hydrogen bonding. The methoxyphenyl group enhances its lipophilicity and may influence its biological activity. This compound may be of interest in medicinal chemistry due to its potential pharmacological properties, as derivatives of amides often exhibit various biological activities. Additionally, the presence of the bromine atom can facilitate further chemical modifications, making it a versatile intermediate in synthetic pathways. Overall, 2-Bromo-N-[(3-methoxyphenyl)methyl]butanamide is a complex organic molecule with unique characteristics that may be explored for various applications in research and industry.
Formula:C12H16BrNO2
InChI:InChI=1S/C12H16BrNO2/c1-3-11(13)12(15)14-8-9-5-4-6-10(7-9)16-2/h4-7,11H,3,8H2,1-2H3,(H,14,15)
InChI key:InChIKey=GCSGZSBKJAWSAW-UHFFFAOYSA-N
SMILES:C(NC(C(CC)Br)=O)C1=CC(OC)=CC=C1
Synonyms:
  • 2-Bromo-N-[(3-methoxyphenyl)methyl]butanamide
  • Butanamide, 2-bromo-N-[(3-methoxyphenyl)methyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.