CAS 1119452-56-0

5-Fluoro-2-benzoxazoleethanamine

Description:

5-Fluoro-2-benzoxazoleethanamine is a chemical compound characterized by its unique structure, which includes a benzoxazole ring and an ethylamine side chain. The presence of a fluorine atom at the 5-position of the benzoxazole contributes to its chemical reactivity and potential biological activity. This compound is typically classified as an aromatic amine, which may exhibit properties such as moderate solubility in organic solvents and limited solubility in water, depending on the specific functional groups present. The benzoxazole moiety is known for its applications in pharmaceuticals and agrochemicals, often serving as a scaffold for drug development due to its ability to interact with biological targets. Additionally, the compound may exhibit fluorescence properties, making it useful in various analytical applications. Its synthesis and characterization would involve standard organic chemistry techniques, and it may be of interest in medicinal chemistry research, particularly in the development of compounds with potential therapeutic effects. As with any chemical substance, safety data and handling precautions should be reviewed before use.

Formula: C₉H₉FN₂O

InChI: InChI=1S/C9H9FN2O/c10-6-1-2-8-7(5-6)12-9(13-8)3-4-11/h1-2,5H,3-4,11H2

InChI key: InChIKey=WYFWALGOHDUGNZ-UHFFFAOYSA-N

SMILES: C(CN)C1=NC=2C(O1)=CC=C(F)C2

Synonyms:

• 2-Benzoxazoleethanamine, 5-fluoro-
• 5-Fluoro-2-benzoxazoleethanamine