CAS 1119452-60-6

3-(Aminomethyl)-N-methyl-1,2,4-oxadiazole-5-carboxamide

Description:

3-(Aminomethyl)-N-methyl-1,2,4-oxadiazole-5-carboxamide is a chemical compound characterized by its oxadiazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms and three carbon atoms. This compound features an aminomethyl group and a methyl group attached to the nitrogen atom of the oxadiazole, contributing to its unique properties. The carboxamide functional group enhances its solubility in polar solvents and may influence its biological activity. The presence of the oxadiazole moiety suggests potential applications in pharmaceuticals, particularly in the development of antimicrobial or anti-inflammatory agents, due to the heterocyclic nature of the compound. Additionally, the compound's structure may allow for interactions with biological targets, making it of interest in medicinal chemistry. Its specific physical and chemical properties, such as melting point, boiling point, and solubility, would typically be determined through experimental methods or detailed literature studies. Overall, this compound represents a class of heterocyclic compounds with potential utility in various chemical and biological applications.

Formula: C₅H₈N₄O₂

InChI: InChI=1S/C5H8N4O2/c1-7-4(10)5-8-3(2-6)9-11-5/h2,6H2,1H3,(H,7,10)

InChI key: InChIKey=HNJTWSDQTFAEOK-UHFFFAOYSA-N

SMILES: C(NC)(=O)C1=NC(CN)=NO1

Synonyms:

• 1,2,4-Oxadiazole-5-carboxamide, 3-(aminomethyl)-N-methyl-
• 3-(Aminomethyl)-N-methyl-1,2,4-oxadiazole-5-carboxamide