CAS 1119452-62-8
:N-Cyclopropyl-3-[5-[(ethylamino)methyl]-1,2,4-oxadiazol-3-yl]benzamide
Description:
N-Cyclopropyl-3-[5-[(ethylamino)methyl]-1,2,4-oxadiazol-3-yl]benzamide, identified by its CAS number 1119452-62-8, is a chemical compound that features a cyclopropyl group and a benzamide structure, which contributes to its potential biological activity. The presence of the 1,2,4-oxadiazole moiety suggests that it may exhibit interesting pharmacological properties, as oxadiazoles are known for their diverse biological activities, including antimicrobial and anti-inflammatory effects. The ethylamino substituent enhances its solubility and may influence its interaction with biological targets. This compound is likely to be a solid at room temperature, with moderate stability under standard conditions. Its molecular structure indicates potential for various applications in medicinal chemistry, particularly in the development of new therapeutic agents. However, specific data regarding its toxicity, solubility, and reactivity would require further investigation through experimental studies. Overall, N-Cyclopropyl-3-[5-[(ethylamino)methyl]-1,2,4-oxadiazol-3-yl]benzamide represents a compound of interest for research in drug discovery and development.
Formula:C15H18N4O2
InChI:InChI=1S/C15H18N4O2/c1-2-16-9-13-18-14(19-21-13)10-4-3-5-11(8-10)15(20)17-12-6-7-12/h3-5,8,12,16H,2,6-7,9H2,1H3,(H,17,20)
InChI key:InChIKey=ONIVOFKXFQCLFM-UHFFFAOYSA-N
SMILES:C(NCC)C1=NC(=NO1)C2=CC(C(NC3CC3)=O)=CC=C2
Synonyms:- N-Cyclopropyl-3-[5-[(ethylamino)methyl]-1,2,4-oxadiazol-3-yl]benzamide
- Benzamide, N-cyclopropyl-3-[5-[(ethylamino)methyl]-1,2,4-oxadiazol-3-yl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.