CAS 1119452-67-3
:3-[5-(Chloromethyl)-1,2,4-oxadiazol-3-yl]-N-(1-methylethyl)benzamide
Description:
3-[5-(Chloromethyl)-1,2,4-oxadiazol-3-yl]-N-(1-methylethyl)benzamide is a chemical compound characterized by its unique structural features, which include an oxadiazole ring and a benzamide moiety. The presence of the chloromethyl group enhances its reactivity, making it a potential candidate for various chemical reactions. This compound is likely to exhibit properties typical of both aromatic and heterocyclic compounds, such as stability and the ability to participate in electrophilic substitution reactions. The oxadiazole ring contributes to its potential biological activity, as many oxadiazole derivatives are known for their antimicrobial and anti-inflammatory properties. Additionally, the isopropyl group attached to the benzamide nitrogen may influence its solubility and lipophilicity, affecting its pharmacokinetic profile. Overall, this compound's unique combination of functional groups suggests potential applications in medicinal chemistry and material science, although specific biological activity and toxicity data would require further investigation.
Formula:C13H14ClN3O2
InChI:InChI=1S/C13H14ClN3O2/c1-8(2)15-13(18)10-5-3-4-9(6-10)12-16-11(7-14)19-17-12/h3-6,8H,7H2,1-2H3,(H,15,18)
InChI key:InChIKey=BEUDZRIUDJCYPA-UHFFFAOYSA-N
SMILES:C(NC(C)C)(=O)C=1C=C(C=CC1)C=2N=C(CCl)ON2
Synonyms:- Benzamide, 3-[5-(chloromethyl)-1,2,4-oxadiazol-3-yl]-N-(1-methylethyl)-
- 3-[5-(Chloromethyl)-1,2,4-oxadiazol-3-yl]-N-(1-methylethyl)benzamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.