CymitQuimica logo

CAS 1119452-71-9

:

3-[5-(Chloromethyl)-1,2,4-oxadiazol-3-yl]benzoyl chloride

Description:
3-[5-(Chloromethyl)-1,2,4-oxadiazol-3-yl]benzoyl chloride is a chemical compound characterized by its unique structure, which includes a benzoyl chloride moiety and a 1,2,4-oxadiazole ring. The presence of the chloromethyl group on the oxadiazole enhances its reactivity, making it a potential intermediate in organic synthesis. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability under certain conditions and the ability to participate in electrophilic substitution reactions. The benzoyl chloride functional group contributes to its reactivity, particularly in acylation reactions. Additionally, the oxadiazole ring is known for its applications in pharmaceuticals and agrochemicals due to its biological activity. Safety considerations are important when handling this compound, as it may be toxic or irritant, necessitating appropriate precautions. Overall, 3-[5-(Chloromethyl)-1,2,4-oxadiazol-3-yl]benzoyl chloride is a versatile compound with potential applications in various fields of chemistry.
Formula:C10H6Cl2N2O2
InChI:InChI=1S/C10H6Cl2N2O2/c11-5-8-13-10(14-16-8)7-3-1-2-6(4-7)9(12)15/h1-4H,5H2
InChI key:InChIKey=HJRGPUANWLVKTD-UHFFFAOYSA-N
SMILES:C(Cl)C1=NC(=NO1)C2=CC(C(Cl)=O)=CC=C2
Synonyms:
  • Benzoyl chloride, 3-[5-(chloromethyl)-1,2,4-oxadiazol-3-yl]-
  • 3-[5-(Chloromethyl)-1,2,4-oxadiazol-3-yl]benzoyl chloride
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.