CAS 1119452-73-1

2-[[[5-[(Cyclopropylamino)carbonyl]-1,2,4-oxadiazol-3-yl]methyl]thio]acetic acid

Description:

2-[[[5-[(Cyclopropylamino)carbonyl]-1,2,4-oxadiazol-3-yl]methyl]thio]acetic acid is a chemical compound characterized by its complex structure, which includes an oxadiazole ring, a cyclopropylamino group, and a thioether linkage. This compound typically exhibits properties such as moderate solubility in polar solvents due to the presence of both hydrophilic and hydrophobic regions in its molecular structure. The oxadiazole moiety is known for its potential biological activity, often contributing to the compound's pharmacological properties. The cyclopropylamino group may enhance the compound's interaction with biological targets, potentially influencing its efficacy and selectivity. Additionally, the presence of the acetic acid functional group suggests that the compound may exhibit acidic properties, which could affect its behavior in various chemical environments. Overall, this compound's unique structural features may make it of interest in medicinal chemistry and drug development, although specific biological activities would require further investigation.

Formula: C₉H₁₁N₃O₄S

InChI: InChI=1S/C9H11N3O4S/c13-7(14)4-17-3-6-11-9(16-12-6)8(15)10-5-1-2-5/h5H,1-4H2,(H,10,15)(H,13,14)

InChI key: InChIKey=YSVVVVSIFNLNDH-UHFFFAOYSA-N

SMILES: C(NC1CC1)(=O)C2=NC(CSCC(O)=O)=NO2

Synonyms:

• 2-[[[5-[(Cyclopropylamino)carbonyl]-1,2,4-oxadiazol-3-yl]methyl]thio]acetic acid
• Acetic acid, 2-[[[5-[(cyclopropylamino)carbonyl]-1,2,4-oxadiazol-3-yl]methyl]thio]-