CAS 1119452-76-4

3-[4-Methoxy-3-[(3-methyl-1-piperidinyl)methyl]phenyl]-2-propenoic acid

Description:

3-[4-Methoxy-3-[(3-methyl-1-piperidinyl)methyl]phenyl]-2-propenoic acid, identified by its CAS number 1119452-76-4, is a synthetic organic compound characterized by its complex structure, which includes a propenoic acid moiety and a methoxy-substituted phenyl group. This compound features a piperidine ring, which contributes to its potential biological activity, particularly in medicinal chemistry. The presence of the methoxy group enhances its lipophilicity, potentially influencing its pharmacokinetic properties. The propenoic acid functional group suggests that it may participate in various chemical reactions, including esterification and polymerization. Its unique structure may confer specific interactions with biological targets, making it of interest in drug development and research. As with many organic compounds, its solubility, stability, and reactivity can vary based on environmental conditions such as pH and temperature. Overall, this compound exemplifies the intricate relationship between molecular structure and biological function, warranting further investigation for potential therapeutic applications.

Formula: C₁₇H₂₃NO₃

InChI: InChI=1S/C17H23NO3/c1-13-4-3-9-18(11-13)12-15-10-14(6-8-17(19)20)5-7-16(15)21-2/h5-8,10,13H,3-4,9,11-12H2,1-2H3,(H,19,20)

InChI key: InChIKey=IRLOHWFXLGDKOU-UHFFFAOYSA-N

SMILES: C(C1=C(OC)C=CC(C=CC(O)=O)=C1)N2CC(C)CCC2

Synonyms:

• 2-Propenoic acid, 3-[4-methoxy-3-[(3-methyl-1-piperidinyl)methyl]phenyl]-
• 3-[4-Methoxy-3-[(3-methyl-1-piperidinyl)methyl]phenyl]-2-propenoic acid