CymitQuimica logo

CAS 1119452-77-5

:

3-[4-Methoxy-3-[(2,2,2-trifluoroethoxy)methyl]phenyl]-2-propenoic acid

Description:
3-[4-Methoxy-3-[(2,2,2-trifluoroethoxy)methyl]phenyl]-2-propenoic acid, identified by its CAS number 1119452-77-5, is an organic compound characterized by its complex structure, which includes a propenoic acid moiety and a methoxy-substituted phenyl group. This compound features a trifluoroethoxy group, which contributes to its unique chemical properties, including increased lipophilicity and potential biological activity. The presence of the methoxy group enhances its solubility in organic solvents and may influence its reactivity and interaction with biological targets. As a propenoic acid derivative, it may exhibit properties typical of unsaturated carboxylic acids, such as the ability to participate in various chemical reactions, including polymerization and esterification. The trifluoromethyl group is known for imparting distinctive electronic effects, which can affect the compound's stability and reactivity. Overall, this compound's unique functional groups suggest potential applications in pharmaceuticals or agrochemicals, although specific biological activities would require further investigation.
Formula:C13H13F3O4
InChI:InChI=1S/C13H13F3O4/c1-19-11-4-2-9(3-5-12(17)18)6-10(11)7-20-8-13(14,15)16/h2-6H,7-8H2,1H3,(H,17,18)
InChI key:InChIKey=WNRMPDTUWWSIEU-UHFFFAOYSA-N
SMILES:C(OCC(F)(F)F)C1=C(OC)C=CC(C=CC(O)=O)=C1
Synonyms:
  • 2-Propenoic acid, 3-[4-methoxy-3-[(2,2,2-trifluoroethoxy)methyl]phenyl]-
  • 3-[4-Methoxy-3-[(2,2,2-trifluoroethoxy)methyl]phenyl]-2-propenoic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.