CAS 1119452-80-0

α,α,4-Trimethyl-1-piperazinepropanal oxime

Description:

α,α,4-Trimethyl-1-piperazinepropanal oxime is a chemical compound characterized by its unique structural features, which include a piperazine ring and an oxime functional group. The presence of the trimethyl groups contributes to its steric bulk, potentially influencing its reactivity and interactions with other molecules. This compound is likely to exhibit properties typical of oximes, such as the ability to form hydrogen bonds due to the hydroxyl group, which can enhance solubility in polar solvents. Additionally, the piperazine moiety may impart basicity and the potential for forming coordination complexes with metal ions. The compound's specific applications may vary, but it could be relevant in fields such as pharmaceuticals, agrochemicals, or materials science, where oxime derivatives are often utilized for their reactivity and ability to serve as intermediates in synthetic pathways. As with any chemical substance, safety data and handling precautions should be consulted to ensure proper management in laboratory or industrial settings.

Formula: C₁₀H₂₁N₃O

InChI: InChI=1S/C10H21N3O/c1-10(2,8-11-14)9-13-6-4-12(3)5-7-13/h8,14H,4-7,9H2,1-3H3

InChI key: InChIKey=YRXNIQZGKXJUFH-UHFFFAOYSA-N

SMILES: C(C(C=NO)(C)C)N1CCN(C)CC1

Synonyms:

• α,α,4-Trimethyl-1-piperazinepropanal oxime
• 1-Piperazinepropanal, α,α,4-trimethyl-, oxime