CAS 1119452-87-7

1-[(5-Methyl-2-phenyl-4-oxazolyl)methyl]-4-piperidinecarboxylic acid

Description:

1-[(5-Methyl-2-phenyl-4-oxazolyl)methyl]-4-piperidinecarboxylic acid is a chemical compound characterized by its complex structure, which includes a piperidine ring and an oxazole moiety. The presence of the 5-methyl-2-phenyl-4-oxazolyl group contributes to its potential biological activity, making it of interest in medicinal chemistry. This compound is likely to exhibit properties such as moderate solubility in organic solvents and potential interactions with biological targets due to its functional groups. The carboxylic acid group may impart acidic characteristics, influencing its reactivity and solubility in aqueous environments. Additionally, the compound's molecular structure suggests it could participate in hydrogen bonding, which may affect its pharmacokinetic properties. Overall, the unique combination of functional groups in this compound positions it as a candidate for further research in drug development and related fields. However, specific data regarding its physical properties, biological activity, and safety profile would require empirical investigation and should be consulted from reliable scientific literature or databases.

Formula: C₁₇H₂₀N₂O₃

InChI: InChI=1S/C17H20N2O3/c1-12-15(11-19-9-7-14(8-10-19)17(20)21)18-16(22-12)13-5-3-2-4-6-13/h2-6,14H,7-11H2,1H3,(H,20,21)

InChI key: InChIKey=JNXPLXPHVHJGAI-UHFFFAOYSA-N

SMILES: C(C=1N=C(OC1C)C2=CC=CC=C2)N3CCC(C(O)=O)CC3

Synonyms:

• 4-Piperidinecarboxylic acid, 1-[(5-methyl-2-phenyl-4-oxazolyl)methyl]-
• 1-[(5-Methyl-2-phenyl-4-oxazolyl)methyl]-4-piperidinecarboxylic acid