CAS 1119452-89-9
:1-[4-[(3-Methylbutyl)amino]-1-piperidinyl]ethanone
Description:
1-[4-[(3-Methylbutyl)amino]-1-piperidinyl]ethanone, identified by its CAS number 1119452-89-9, is a chemical compound that belongs to the class of piperidine derivatives. This substance features a piperidine ring, which is a six-membered nitrogen-containing heterocycle, and is substituted with an ethanone group and a 3-methylbutyl amino group. The presence of the piperidine structure often imparts significant biological activity, making such compounds of interest in medicinal chemistry. The compound is likely to exhibit moderate to high lipophilicity due to the alkyl substituents, which can influence its pharmacokinetic properties, such as absorption and distribution in biological systems. Additionally, the functional groups present may contribute to its reactivity and potential interactions with biological targets. As with many organic compounds, its stability, solubility, and reactivity can vary based on environmental conditions such as pH and temperature. Further studies would be necessary to fully elucidate its properties and potential applications in various fields, including pharmaceuticals.
Formula:C12H24N2O
InChI:InChI=1S/C12H24N2O/c1-10(2)4-7-13-12-5-8-14(9-6-12)11(3)15/h10,12-13H,4-9H2,1-3H3
InChI key:InChIKey=PVPQEZCKPMDKCA-UHFFFAOYSA-N
SMILES:N(CCC(C)C)C1CCN(C(C)=O)CC1
Synonyms:- Ethanone, 1-[4-[(3-methylbutyl)amino]-1-piperidinyl]-
- 1-[4-[(3-Methylbutyl)amino]-1-piperidinyl]ethanone
- 1-acetyl-N-(3-methylbutyl)piperidin-4-amine
- 1-[4-(3-methylbutylamino)piperidin-1-yl]ethanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.