CymitQuimica logo

CAS 1119452-93-5

:

N-Methyl-N-[(1,2,3,4-tetrahydro-2-oxo-6-quinolinyl)sulfonyl]glycine

Description:
N-Methyl-N-[(1,2,3,4-tetrahydro-2-oxo-6-quinolinyl)sulfonyl]glycine, identified by its CAS number 1119452-93-5, is a chemical compound characterized by its unique structure that combines a glycine moiety with a sulfonyl group and a quinoline derivative. This compound typically exhibits properties associated with both amino acids and sulfonamides, which may influence its solubility, reactivity, and potential biological activity. The presence of the quinoline ring suggests potential pharmacological applications, as quinolines are known for their diverse biological activities, including antimicrobial and antimalarial properties. The sulfonyl group can enhance the compound's stability and solubility in various solvents. Additionally, the methylation of the nitrogen atom in the glycine structure may affect its interaction with biological targets, potentially influencing its efficacy in therapeutic applications. Overall, this compound's characteristics make it a subject of interest in medicinal chemistry and drug development, particularly in the context of designing novel therapeutic agents.
Formula:C12H14N2O5S
InChI:InChI=1S/C12H14N2O5S/c1-14(7-12(16)17)20(18,19)9-3-4-10-8(6-9)2-5-11(15)13-10/h3-4,6H,2,5,7H2,1H3,(H,13,15)(H,16,17)
InChI key:InChIKey=SDGVGTAZQNSMND-UHFFFAOYSA-N
SMILES:S(N(CC(O)=O)C)(=O)(=O)C=1C=C2C(=CC1)NC(=O)CC2
Synonyms:
  • Glycine, N-methyl-N-[(1,2,3,4-tetrahydro-2-oxo-6-quinolinyl)sulfonyl]-
  • N-Methyl-N-[(1,2,3,4-tetrahydro-2-oxo-6-quinolinyl)sulfonyl]glycine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.