CAS 1119453-01-8
:2-Bromo-1-(4-methyl-1-piperazinyl)-1-butanone
Description:
2-Bromo-1-(4-methyl-1-piperazinyl)-1-butanone is a chemical compound characterized by its unique structure, which includes a bromine atom and a piperazine ring. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It has a molecular formula that reflects the presence of a butanone moiety, contributing to its reactivity and potential applications in organic synthesis. The piperazine group enhances its biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. The bromine substituent can serve as a leaving group in nucleophilic substitution reactions, facilitating further chemical transformations. Additionally, this compound may exhibit specific solubility characteristics, often being soluble in organic solvents while having limited solubility in water. Safety data should be consulted, as halogenated compounds can pose health risks, and appropriate handling procedures are essential in laboratory settings. Overall, 2-Bromo-1-(4-methyl-1-piperazinyl)-1-butanone is a versatile compound with potential applications in various fields of chemistry and pharmacology.
Formula:C9H17BrN2O
InChI:InChI=1S/C9H17BrN2O/c1-3-8(10)9(13)12-6-4-11(2)5-7-12/h8H,3-7H2,1-2H3
InChI key:InChIKey=BDUODBYDTACSKG-UHFFFAOYSA-N
SMILES:C(C(CC)Br)(=O)N1CCN(C)CC1
Synonyms:- 2-Bromo-1-(4-methyl-1-piperazinyl)-1-butanone
- 1-Butanone, 2-bromo-1-(4-methyl-1-piperazinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.