CAS 1119453-02-9

1-Butyl-N-(2-furanylmethyl)-1,2,3,4-tetrahydro-6-quinolinemethanamine

Description:

1-Butyl-N-(2-furanylmethyl)-1,2,3,4-tetrahydro-6-quinolinemethanamine is a chemical compound characterized by its complex structure, which includes a quinoline core fused with a tetrahydro ring and a butyl side chain. The presence of a furan moiety contributes to its unique reactivity and potential biological activity. This compound may exhibit properties typical of both amines and heterocycles, such as basicity and the ability to participate in various chemical reactions, including nucleophilic substitutions and cyclizations. Its structural features suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting neurological or other disorders. The compound's solubility, stability, and reactivity can vary based on environmental conditions and the presence of functional groups. As with many organic compounds, safety and handling precautions are essential, particularly due to the potential for biological activity. Further studies would be necessary to fully elucidate its properties and potential applications in various fields, including drug development and materials science.

Formula: C₁₉H₂₆N₂O

InChI: InChI=1S/C19H26N2O/c1-2-3-10-21-11-4-6-17-13-16(8-9-19(17)21)14-20-15-18-7-5-12-22-18/h5,7-9,12-13,20H,2-4,6,10-11,14-15H2,1H3

InChI key: InChIKey=PLTHSBGPWPHUGC-UHFFFAOYSA-N

SMILES: C(CCC)N1C=2C(=CC(CNCC3=CC=CO3)=CC2)CCC1

Synonyms:

• 1-Butyl-N-(2-furanylmethyl)-1,2,3,4-tetrahydro-6-quinolinemethanamine
• 6-Quinolinemethanamine, 1-butyl-N-(2-furanylmethyl)-1,2,3,4-tetrahydro-
• N-[(1-butyl-1,2,3,4-tetrahydroquinolin-6-yl)methyl]-N-(2-furylmethyl)amine
• 1-(1-butyl-3,4-dihydro-2H-quinolin-6-yl)-N-(furan-2-ylmethyl)methanamine