CymitQuimica logo

CAS 1119453-04-1

:

N<sup>1</sup>,N<sup>1</sup>-Diethyl-N<sup>3</sup>-[(1,2,3,4-tetrahydro-1-methyl-6-quinolinyl)methyl]-1,3-propanediamine

Description:
N^1,N^1-Diethyl-N^3-[(1,2,3,4-tetrahydro-1-methyl-6-quinolinyl)methyl]-1,3-propanediamine is a chemical compound characterized by its complex structure, which includes a propanediamine backbone and a quinoline-derived moiety. This compound features two ethyl groups attached to the nitrogen atoms at the N^1 position, contributing to its lipophilicity and potential biological activity. The presence of the tetrahydroquinoline ring suggests that it may exhibit pharmacological properties, possibly interacting with neurotransmitter systems or other biological targets. Its molecular structure indicates potential for use in medicinal chemistry, particularly in the development of therapeutic agents. The compound's CAS number, 1119453-04-1, allows for its identification in chemical databases, facilitating research and application in various fields, including drug discovery and development. As with many organic compounds, its solubility, stability, and reactivity would depend on environmental conditions and the presence of functional groups. Further studies would be necessary to fully elucidate its properties and potential applications.
Formula:C18H31N3
InChI:InChI=1S/C18H31N3/c1-4-21(5-2)13-7-11-19-15-16-9-10-18-17(14-16)8-6-12-20(18)3/h9-10,14,19H,4-8,11-13,15H2,1-3H3
InChI key:InChIKey=XGGRJYIPNHRVSM-UHFFFAOYSA-N
SMILES:CN1C=2C(=CC(CNCCCN(CC)CC)=CC2)CCC1
Synonyms:
  • 1,3-Propanediamine, N1,N1-diethyl-N3-[(1,2,3,4-tetrahydro-1-methyl-6-quinolinyl)methyl]-
  • N1,N1-Diethyl-N3-[(1,2,3,4-tetrahydro-1-methyl-6-quinolinyl)methyl]-1,3-propanediamine
  • N,N-diethyl-N'-[(1-methyl-1,2,3,4-tetrahydroquinolin-6-yl)methyl]propane-1,3-diamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.