CAS 1119453-07-4
:2-Bromo-N-(2-furanylmethyl)-N-(3-methoxypropyl)butanamide
Description:
2-Bromo-N-(2-furanylmethyl)-N-(3-methoxypropyl)butanamide is a chemical compound characterized by its unique structure, which includes a bromine atom, a furan ring, and a butanamide moiety. The presence of the furan ring contributes to its potential reactivity and biological activity, as furan derivatives are known for their roles in various chemical reactions and as intermediates in organic synthesis. The butanamide functional group indicates that the compound may exhibit properties typical of amides, such as hydrogen bonding capabilities, which can influence its solubility and interaction with biological systems. The methoxypropyl substituent adds to the compound's complexity and may enhance its lipophilicity, affecting its pharmacokinetic properties. Overall, this compound's structural features suggest potential applications in medicinal chemistry, particularly in the development of new pharmaceuticals or agrochemicals, although specific biological activities would require further investigation through experimental studies.
Formula:C13H20BrNO3
InChI:InChI=1S/C13H20BrNO3/c1-3-12(14)13(16)15(7-5-8-17-2)10-11-6-4-9-18-11/h4,6,9,12H,3,5,7-8,10H2,1-2H3
InChI key:InChIKey=SCXFQCMOLMSCPL-UHFFFAOYSA-N
SMILES:N(CC1=CC=CO1)(C(C(CC)Br)=O)CCCOC
Synonyms:- 2-Bromo-N-(2-furanylmethyl)-N-(3-methoxypropyl)butanamide
- Butanamide, 2-bromo-N-(2-furanylmethyl)-N-(3-methoxypropyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.