CAS 1119453-08-5

2-Bromo-N-(3-methylbutyl)butanamide

Description:

2-Bromo-N-(3-methylbutyl)butanamide is an organic compound characterized by its amide functional group, which is derived from butanoic acid and contains a bromine atom at the second carbon position. This compound features a branched alkyl chain, specifically a 3-methylbutyl group, which contributes to its hydrophobic characteristics. The presence of the bromine atom enhances its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. The molecular structure suggests moderate polarity due to the amide group, which can engage in hydrogen bonding, influencing its solubility in polar solvents. Additionally, the compound's molecular weight and specific functional groups may affect its boiling and melting points, as well as its stability under different conditions. As with many brominated compounds, it may exhibit unique biological activities, making it of interest in medicinal chemistry and material science. Safety and handling precautions should be observed due to the potential toxicity associated with brominated organic compounds.

Formula: C₉H₁₈BrNO

InChI: InChI=1S/C9H18BrNO/c1-4-8(10)9(12)11-6-5-7(2)3/h7-8H,4-6H2,1-3H3,(H,11,12)

InChI key: InChIKey=UHIXHZQDEYTIBY-UHFFFAOYSA-N

SMILES: C(NCCC(C)C)(C(CC)Br)=O

Synonyms:

• 2-Bromo-N-(3-methylbutyl)butanamide
• Butanamide, 2-bromo-N-(3-methylbutyl)-