CAS 1119453-09-6
:2-Bromo-N-[(2,4-dimethoxyphenyl)methyl]butanamide
Description:
2-Bromo-N-[(2,4-dimethoxyphenyl)methyl]butanamide is a chemical compound characterized by its unique structure, which includes a butanamide backbone substituted with a bromine atom and a dimethoxyphenyl group. The presence of the bromine atom introduces notable reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. The dimethoxyphenyl moiety contributes to the compound's lipophilicity and may influence its biological activity, potentially enhancing its interaction with biological targets. This compound is likely to exhibit moderate to high stability under standard conditions, but its reactivity can vary depending on the surrounding environment and the presence of other functional groups. Additionally, the dimethoxy groups can affect the compound's solubility and polarity, which are important factors in its application in medicinal chemistry or as a synthetic intermediate. Overall, 2-Bromo-N-[(2,4-dimethoxyphenyl)methyl]butanamide presents a versatile framework for further chemical exploration and potential therapeutic applications.
Formula:C13H18BrNO3
InChI:InChI=1S/C13H18BrNO3/c1-4-11(14)13(16)15-8-9-5-6-10(17-2)7-12(9)18-3/h5-7,11H,4,8H2,1-3H3,(H,15,16)
InChI key:InChIKey=CTOZZZIPGGFSTI-UHFFFAOYSA-N
SMILES:C(NC(C(CC)Br)=O)C1=C(OC)C=C(OC)C=C1
Synonyms:- Butanamide, 2-bromo-N-[(2,4-dimethoxyphenyl)methyl]-
- 2-Bromo-N-[(2,4-dimethoxyphenyl)methyl]butanamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.