CymitQuimica logo

CAS 1119453-10-9

:

2-Bromo-N-[2-(1-cyclohexen-1-yl)ethyl]propanamide

Description:
2-Bromo-N-[2-(1-cyclohexen-1-yl)ethyl]propanamide is an organic compound characterized by its unique structure, which includes a bromine atom, an amide functional group, and a cyclohexene moiety. The presence of the bromine atom introduces notable reactivity, making it a potential candidate for various chemical transformations, such as nucleophilic substitution reactions. The amide group contributes to the compound's polarity and solubility in polar solvents, while the cyclohexene ring adds to its hydrophobic character and can influence its reactivity due to the presence of a double bond. This compound may exhibit interesting biological activities, making it of interest in medicinal chemistry. Its synthesis typically involves the introduction of the bromine atom and the formation of the amide linkage, which can be achieved through standard organic synthesis techniques. Overall, 2-Bromo-N-[2-(1-cyclohexen-1-yl)ethyl]propanamide is a versatile compound with potential applications in various fields, including pharmaceuticals and materials science.
Formula:C11H18BrNO
InChI:InChI=1S/C11H18BrNO/c1-9(12)11(14)13-8-7-10-5-3-2-4-6-10/h5,9H,2-4,6-8H2,1H3,(H,13,14)
InChI key:InChIKey=ZMSWJQNUQIADHR-UHFFFAOYSA-N
SMILES:C(CNC(C(Br)C)=O)C=1CCCCC1
Synonyms:
  • 2-Bromo-N-[2-(1-cyclohexen-1-yl)ethyl]propanamide
  • Propanamide, 2-bromo-N-[2-(1-cyclohexen-1-yl)ethyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.