CymitQuimica logo

CAS 1119453-12-1

:

1-[6-(3-Methylphenyl)-3-pyridazinyl]-4-piperidinecarboxylic acid

Description:
1-[6-(3-Methylphenyl)-3-pyridazinyl]-4-piperidinecarboxylic acid, with the CAS number 1119453-12-1, is a chemical compound characterized by its complex structure, which includes a piperidine ring and a pyridazine moiety. This compound features a carboxylic acid functional group, contributing to its potential acidity and reactivity. The presence of a 3-methylphenyl substituent enhances its lipophilicity, which may influence its biological activity and solubility properties. The pyridazine ring is known for its role in various pharmacological applications, often associated with neuroactive and anti-inflammatory properties. The compound's structural features suggest potential interactions with biological targets, making it of interest in medicinal chemistry. Its synthesis and characterization would typically involve standard organic chemistry techniques, and its stability and reactivity would be influenced by the functional groups present. Overall, this compound represents a class of heterocyclic compounds that may exhibit significant pharmacological potential, warranting further investigation in drug development contexts.
Formula:C17H19N3O2
InChI:InChI=1S/C17H19N3O2/c1-12-3-2-4-14(11-12)15-5-6-16(19-18-15)20-9-7-13(8-10-20)17(21)22/h2-6,11,13H,7-10H2,1H3,(H,21,22)
InChI key:InChIKey=ABBZKRJODFHUIV-UHFFFAOYSA-N
SMILES:CC=1C=C(C2=CC=C(N=N2)N3CCC(C(O)=O)CC3)C=CC1
Synonyms:
  • 1-[6-(3-Methylphenyl)-3-pyridazinyl]-4-piperidinecarboxylic acid
  • 4-Piperidinecarboxylic acid, 1-[6-(3-methylphenyl)-3-pyridazinyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.