CAS 111946-84-0

1-(4-bromophenyl)-2-(4-nitrophenoxy)ethanone

Description:

1-(4-bromophenyl)-2-(4-nitrophenoxy)ethanone, with the CAS number 111946-84-0, is an organic compound characterized by its complex aromatic structure. It features a bromophenyl group and a nitrophenoxy group attached to an ethanone moiety, which contributes to its reactivity and potential applications in organic synthesis. The presence of the bromine atom enhances its electrophilic character, making it a useful intermediate in various chemical reactions, including nucleophilic substitutions. The nitro group, known for its electron-withdrawing properties, can influence the compound's reactivity and stability. This compound is typically solid at room temperature and may exhibit moderate solubility in organic solvents. Its unique combination of functional groups suggests potential applications in pharmaceuticals, agrochemicals, or as a building block in the synthesis of more complex molecules. Safety data should be consulted for handling, as the presence of bromine and nitro groups may pose health and environmental risks.

Formula: C₁₄H₁₀BrNO₄

InChI: InChI=1/C14H10BrNO4/c15-11-3-1-10(2-4-11)14(17)9-20-13-7-5-12(6-8-13)16(18)19/h1-8H,9H2

Synonyms:

• Ethanone, 1-(4-Bromophenyl)-2-(4-Nitrophenoxy)-

1-(4-bromophenyl)-2-(4-nitrophenoxy)ethanone

CAS: 111946-84-0

Formula: C₁₄H₁₀BrNO₄

Purity: 95.0%

Molecular weight: 336.141

Ref: 10-F313916