CymitQuimica logo

CAS 1119499-74-9

:

1-(2,2-Difluoroethyl)-4-piperidinamine

Description:
1-(2,2-Difluoroethyl)-4-piperidinamine is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. The presence of a difluoroethyl group at the 1-position of the piperidine ring introduces significant polarity and potential for hydrogen bonding, influencing its solubility and reactivity. This compound is typically a solid at room temperature and may exhibit moderate to high stability under standard conditions, although specific stability can depend on environmental factors such as temperature and pH. Its functional groups suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of the amine group which can participate in various chemical reactions. Additionally, the difluoroethyl substituent may enhance biological activity or selectivity in drug design. Safety and handling precautions should be observed, as with many amines, due to potential toxicity and reactivity. Overall, 1-(2,2-Difluoroethyl)-4-piperidinamine represents a compound of interest in both synthetic and applied chemistry contexts.
Formula:C7H14F2N2
InChI:InChI=1S/C7H14F2N2/c8-7(9)5-11-3-1-6(10)2-4-11/h6-7H,1-5,10H2
InChI key:InChIKey=GNQSOMJHGLZMJE-UHFFFAOYSA-N
SMILES:C(C(F)F)N1CCC(N)CC1
Synonyms:
  • 1-(2,2-Difluoro-ethyl)piperidin-4-ylamine
  • 4-Piperidinamine, 1-(2,2-difluoroethyl)-
  • 1-(2,2-Difluoroethyl)-4-piperidinamine
Found 1 products.