CAS 1119531-23-5

2-(3,4,5-Trimethoxyphenyl)-1H-imidazole

Description:

2-(3,4,5-Trimethoxyphenyl)-1H-imidazole is an organic compound characterized by its imidazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms. The presence of the 3,4,5-trimethoxyphenyl group indicates that the compound has three methoxy (-OCH3) substituents on a phenyl ring, enhancing its solubility and potentially influencing its biological activity. This compound may exhibit various properties such as moderate to high lipophilicity due to the methoxy groups, which can affect its interaction with biological membranes. Additionally, the imidazole moiety is known for its role in biological systems, particularly in enzyme catalysis and as a building block for various pharmaceuticals. The compound may also display interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its specific reactivity and stability would depend on the surrounding conditions, such as pH and temperature, as well as the presence of other functional groups. Overall, 2-(3,4,5-trimethoxyphenyl)-1H-imidazole represents a versatile structure with potential applications in drug development and research.

Formula: C₁₂H₁₄N₂O₃

InChI: InChI=1S/C12H14N2O3/c1-15-9-6-8(12-13-4-5-14-12)7-10(16-2)11(9)17-3/h4-7H,1-3H3,(H,13,14)

InChI key: InChIKey=MHNRXWRFZQMYSA-UHFFFAOYSA-N

SMILES: O(C)C=1C=C(C=C(OC)C1OC)C=2NC=CN2

Synonyms:

• 1H-Imidazole, 2-(3,4,5-trimethoxyphenyl)-
• 2-(3,4,5-Trimethoxyphenyl)-1H-imidazole