CAS 111954-73-5

3-Pyridinebutanamine, α-methyl-, (S)-

Description:

3-Pyridinebutanamine, α-methyl-, (S)-, with the CAS number 111954-73-5, is a chiral amine characterized by its pyridine ring and a butanamine side chain. This compound features a stereocenter, which contributes to its enantiomeric properties, specifically the (S)-configuration indicating its specific spatial arrangement. It is typically a colorless to pale yellow liquid or solid, depending on its form and purity. The presence of the pyridine moiety imparts basicity and potential for hydrogen bonding, making it soluble in polar solvents. This compound may exhibit biological activity, potentially interacting with neurotransmitter systems, which is of interest in medicinal chemistry. Its structural features suggest it could be involved in various chemical reactions, including alkylation and acylation, and may serve as a precursor or intermediate in the synthesis of more complex organic molecules. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper laboratory practices are followed.

Formula: C₁₀H₁₆N₂

InChI: InChI=1S/C10H16N2/c1-9(11)4-2-5-10-6-3-7-12-8-10/h3,6-9H,2,4-5,11H2,1H3/t9-/m0/s1

InChI key: InChIKey=FVWVJTJAALVOQO-VIFPVBQESA-N

SMILES: C(CC[C@H](C)N)C=1C=CC=NC1

Synonyms:

• (2S)-5-(Pyridin-3-yl)pentan-2-amine
• 3-Pyridinebutanamine, α-methyl-, (S)-